C16H17N5O2 — CID 97369736
[(2S,3aS,7aS)-2-pyrimidin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-pyridazin-4-ylmethanone (PubChem CID 97369736) has the molecular formula C16H17N5O2 and a molecular weight of 311.34 g/mol. Its IUPAC name is [(2S,3aS,7aS)-2-pyrimidin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-pyridazin-4-ylmethanone.
| Compound Name | [(2S,3aS,7aS)-2-pyrimidin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 97369736 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | [(2S,3aS,7aS)-2-pyrimidin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-pyridazin-4-ylmethanone |
| SMILES | O=C(c1ccnnc1)N1CC[C@H]2C[C@@H](c3ccncn3)O[C@@H]2C1 |
| InChI | InChI=1S/C16H17N5O2/c22-16(12-1-5-19-20-8-12)21-6-3-11-7-14(23-15(11)9-21)13-2-4-17-10-18-13/h1-2,4-5,8,10-11,14-15H,3,6-7,9H2/t11-,14-,15+/m0/s1 |
| InChIKey | ZBMWUPAIOQKZTO-TUKIKUTGSA-N |
| XLogP | 1.26 |
| TPSA | 81.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |