C17H18N4O2S — CID 133135852
[(2R,3aR,6aR)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-pyridazin-4-ylmethanone (PubChem CID 133135852) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is [(2R,3aR,6aR)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-pyridazin-4-ylmethanone.
| Compound Name | [(2R,3aR,6aR)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 133135852 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [(2R,3aR,6aR)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-pyridazin-4-ylmethanone |
| SMILES | O=C(c1ccnnc1)N1C[C@H]2C[C@H](c3nc(C4CC4)cs3)O[C@H]2C1 |
| InChI | InChI=1S/C17H18N4O2S/c22-17(11-3-4-18-19-6-11)21-7-12-5-14(23-15(12)8-21)16-20-13(9-24-16)10-1-2-10/h3-4,6,9-10,12,14-15H,1-2,5,7-8H2/t12-,14-,15+/m1/s1 |
| InChIKey | VBSIOLKFNFOCMM-YUELXQCFSA-N |
| XLogP | 2.41 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |