C16H20N4O2S — CID 97369230
[(2S,3aS,6aS)-2-(1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-ethyl-5-methylpyrazol-3-yl)methanone (PubChem CID 97369230) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is [(2S,3aS,6aS)-2-(1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-ethyl-5-methylpyrazol-3-yl)methanone.
| Compound Name | [(2S,3aS,6aS)-2-(1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-ethyl-5-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 97369230 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [(2S,3aS,6aS)-2-(1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(2-ethyl-5-methylpyrazol-3-yl)methanone |
| SMILES | CCn1nc(C)cc1C(=O)N1C[C@@H]2C[C@@H](c3nccs3)O[C@@H]2C1 |
| InChI | InChI=1S/C16H20N4O2S/c1-3-20-12(6-10(2)18-20)16(21)19-8-11-7-13(22-14(11)9-19)15-17-4-5-23-15/h4-6,11,13-14H,3,7-9H2,1-2H3/t11-,13-,14+/m0/s1 |
| InChIKey | PFTGDVURMYRFFX-FPMFFAJLSA-N |
| XLogP | 2.27 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |