C16H24N4O3 — CID 133139636
(3aS,7S,7aS)-2-(2-ethyl-5-methylpyrazole-3-carbonyl)-N-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide (PubChem CID 133139636) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (3aS,7S,7aS)-2-(2-ethyl-5-methylpyrazole-3-carbonyl)-N-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide.
| Compound Name | (3aS,7S,7aS)-2-(2-ethyl-5-methylpyrazole-3-carbonyl)-N-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
|---|---|
| PubChem CID | 133139636 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (3aS,7S,7aS)-2-(2-ethyl-5-methylpyrazole-3-carbonyl)-N-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)N1C[C@H]2COC[C@@H](C(=O)NC)[C@H]2C1 |
| InChI | InChI=1S/C16H24N4O3/c1-4-20-14(5-10(2)18-20)16(22)19-6-11-8-23-9-13(12(11)7-19)15(21)17-3/h5,11-13H,4,6-9H2,1-3H3,(H,17,21)/t11-,12-,13+/m0/s1 |
| InChIKey | GJYOENWBLAYTNY-RWMBFGLXSA-N |
| XLogP | 0.29 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |