C15H24N4O4S — CID 124790047
N-[[(3S,3aR,6aR)-5-(2-ethyl-5-methylpyrazole-3-carbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide (PubChem CID 124790047) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is N-[[(3S,3aR,6aR)-5-(2-ethyl-5-methylpyrazole-3-carbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3S,3aR,6aR)-5-(2-ethyl-5-methylpyrazole-3-carbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 124790047 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[[(3S,3aR,6aR)-5-(2-ethyl-5-methylpyrazole-3-carbonyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide |
| SMILES | CCn1nc(C)cc1C(=O)N1C[C@H]2[C@@H](CNS(C)(=O)=O)CO[C@H]2C1 |
| InChI | InChI=1S/C15H24N4O4S/c1-4-19-13(5-10(2)17-19)15(20)18-7-12-11(6-16-24(3,21)22)9-23-14(12)8-18/h5,11-12,14,16H,4,6-9H2,1-3H3/t11-,12-,14-/m0/s1 |
| InChIKey | KVEIFEUUSSHJOF-OBJOEFQTSA-N |
| XLogP | -0.15 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |