C19H26N4O2 — CID 97392711
[(2S,3aS,7aS)-2-[2-(dimethylamino)pyrimidin-4-yl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(cyclopenten-1-yl)methanone (PubChem CID 97392711) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is [(2S,3aS,7aS)-2-[2-(dimethylamino)pyrimidin-4-yl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(cyclopenten-1-yl)methanone.
| Compound Name | [(2S,3aS,7aS)-2-[2-(dimethylamino)pyrimidin-4-yl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(cyclopenten-1-yl)methanone |
|---|---|
| PubChem CID | 97392711 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | [(2S,3aS,7aS)-2-[2-(dimethylamino)pyrimidin-4-yl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(cyclopenten-1-yl)methanone |
| SMILES | CN(C)c1nccc([C@@H]2C[C@@H]3CCN(C(=O)C4=CCCC4)C[C@H]3O2)n1 |
| InChI | InChI=1S/C19H26N4O2/c1-22(2)19-20-9-7-15(21-19)16-11-14-8-10-23(12-17(14)25-16)18(24)13-5-3-4-6-13/h5,7,9,14,16-17H,3-4,6,8,10-12H2,1-2H3/t14-,16-,17+/m0/s1 |
| InChIKey | RQBDIHIBCZRILH-BHYGNILZSA-N |
| XLogP | 2.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |