C18H21N3O2S — CID 97369768
1-[(2S,3aS,7aS)-2-(2-methylpyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-2-thiophen-3-ylethanone (PubChem CID 97369768) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-[(2S,3aS,7aS)-2-(2-methylpyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(2S,3aS,7aS)-2-(2-methylpyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 97369768 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-[(2S,3aS,7aS)-2-(2-methylpyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-2-thiophen-3-ylethanone |
| SMILES | Cc1nccc([C@@H]2C[C@@H]3CCN(C(=O)Cc4ccsc4)C[C@H]3O2)n1 |
| InChI | InChI=1S/C18H21N3O2S/c1-12-19-5-2-15(20-12)16-9-14-3-6-21(10-17(14)23-16)18(22)8-13-4-7-24-11-13/h2,4-5,7,11,14,16-17H,3,6,8-10H2,1H3/t14-,16-,17+/m0/s1 |
| InChIKey | BWWQKPDOPCJUIM-BHYGNILZSA-N |
| XLogP | 2.77 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |