C15H16N4O2S — CID 97369733
[(2S,3aS,7aS)-2-pyrimidin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 97369733) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is [(2S,3aS,7aS)-2-pyrimidin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [(2S,3aS,7aS)-2-pyrimidin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 97369733 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | [(2S,3aS,7aS)-2-pyrimidin-4-yl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1CC[C@H]2C[C@@H](c3ccncn3)O[C@@H]2C1 |
| InChI | InChI=1S/C15H16N4O2S/c20-15(12-7-22-9-18-12)19-4-2-10-5-13(21-14(10)6-19)11-1-3-16-8-17-11/h1,3,7-10,13-14H,2,4-6H2/t10-,13-,14+/m0/s1 |
| InChIKey | RLPOOJXAUQOPEF-LEWSCRJBSA-N |
| XLogP | 1.93 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |