C18H31NO4 — CID 124789276
(8R)-2-(oxan-4-yl)-8-(oxan-4-ylmethoxymethyl)-5-oxa-2-azaspiro[3.4]octane (PubChem CID 124789276) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is (8R)-2-(oxan-4-yl)-8-(oxan-4-ylmethoxymethyl)-5-oxa-2-azaspiro[3.4]octane.
| Compound Name | (8R)-2-(oxan-4-yl)-8-(oxan-4-ylmethoxymethyl)-5-oxa-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 124789276 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | (8R)-2-(oxan-4-yl)-8-(oxan-4-ylmethoxymethyl)-5-oxa-2-azaspiro[3.4]octane |
| SMILES | C1CC(COC[C@H]2CCOC23CN(C2CCOCC2)C3)CCO1 |
| InChI | InChI=1S/C18H31NO4/c1-6-20-7-2-15(1)11-22-12-16-3-10-23-18(16)13-19(14-18)17-4-8-21-9-5-17/h15-17H,1-14H2/t16-/m1/s1 |
| InChIKey | CTWHIMSUQZDYHX-MRXNPFEDSA-N |
| XLogP | 1.70 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |