C16H27NO2 — CID 124791256
(3aR,7aS)-5-cyclobutyl-3a-(cyclopropylmethoxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine (PubChem CID 124791256) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is (3aR,7aS)-5-cyclobutyl-3a-(cyclopropylmethoxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine.
| Compound Name | (3aR,7aS)-5-cyclobutyl-3a-(cyclopropylmethoxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 124791256 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | (3aR,7aS)-5-cyclobutyl-3a-(cyclopropylmethoxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine |
| SMILES | C1CC(N2CC[C@@H]3OCC[C@]3(COCC3CC3)C2)C1 |
| InChI | InChI=1S/C16H27NO2/c1-2-14(3-1)17-8-6-15-16(11-17,7-9-19-15)12-18-10-13-4-5-13/h13-15H,1-12H2/t15-,16+/m0/s1 |
| InChIKey | MBHRJQATOPOUAY-JKSUJKDBSA-N |
| XLogP | 2.45 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |