C21H38N2S2 — CID 124794777
5-[(1S,5S)-3,3,5-trimethylcyclohexyl]-3-[(1S,5R)-3,3,5-trimethylcyclohexyl]-1,3,5-thiadiazinane-2-thione (PubChem CID 124794777) has the molecular formula C21H38N2S2 and a molecular weight of 382.68 g/mol. Its IUPAC name is 5-[(1S,5S)-3,3,5-trimethylcyclohexyl]-3-[(1S,5R)-3,3,5-trimethylcyclohexyl]-1,3,5-thiadiazinane-2-thione.
| Compound Name | 5-[(1S,5S)-3,3,5-trimethylcyclohexyl]-3-[(1S,5R)-3,3,5-trimethylcyclohexyl]-1,3,5-thiadiazinane-2-thione |
|---|---|
| PubChem CID | 124794777 |
| Molecular Formula | C21H38N2S2 |
| Molecular Weight | 382.68 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 5-[(1S,5S)-3,3,5-trimethylcyclohexyl]-3-[(1S,5R)-3,3,5-trimethylcyclohexyl]-1,3,5-thiadiazinane-2-thione |
| SMILES | C[C@@H]1C[C@H](N2CSC(=S)N([C@H]3C[C@H](C)CC(C)(C)C3)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C21H38N2S2/c1-15-7-17(11-20(3,4)9-15)22-13-23(19(24)25-14-22)18-8-16(2)10-21(5,6)12-18/h15-18H,7-14H2,1-6H3/t15-,16+,17+,18+/m1/s1 |
| InChIKey | ODNFMXWLLCNLGE-OWSLCNJRSA-N |
| XLogP | 5.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.68 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|