C17H24N4O4 — CID 124797657
[(4S,4aS,8aS)-6-(6-methoxypyrimidin-4-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 124797657) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is [(4S,4aS,8aS)-6-(6-methoxypyrimidin-4-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone.
| Compound Name | [(4S,4aS,8aS)-6-(6-methoxypyrimidin-4-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 124797657 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | [(4S,4aS,8aS)-6-(6-methoxypyrimidin-4-yl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | COc1cc(N2CC[C@@H]3OCC[C@H](C(=O)N4CCCO4)[C@H]3C2)ncn1 |
| InChI | InChI=1S/C17H24N4O4/c1-23-16-9-15(18-11-19-16)20-6-3-14-13(10-20)12(4-8-24-14)17(22)21-5-2-7-25-21/h9,11-14H,2-8,10H2,1H3/t12-,13+,14-/m0/s1 |
| InChIKey | QZIZWSXPLGRPOY-MJBXVCDLSA-N |
| XLogP | 0.88 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |