C16H22N4O4 — CID 97362669
[(3aR,7S,7aR)-2-(6-methoxypyrimidin-4-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 97362669) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is [(3aR,7S,7aR)-2-(6-methoxypyrimidin-4-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(1,2-oxazolidin-2-yl)methanone.
| Compound Name | [(3aR,7S,7aR)-2-(6-methoxypyrimidin-4-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(1,2-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 97362669 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | [(3aR,7S,7aR)-2-(6-methoxypyrimidin-4-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | COc1cc(N2C[C@@H]3COC[C@@H](C(=O)N4CCCO4)[C@@H]3C2)ncn1 |
| InChI | InChI=1S/C16H22N4O4/c1-22-15-5-14(17-10-18-15)19-6-11-8-23-9-13(12(11)7-19)16(21)20-3-2-4-24-20/h5,10-13H,2-4,6-9H2,1H3/t11-,12-,13-/m1/s1 |
| InChIKey | WFSCWDQQDUCEFH-JHJVBQTASA-N |
| XLogP | 0.35 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |