C21H28FN3O4S — CID 124799755
1-[(3aS,8aS)-6-(3-fluorophenyl)sulfonyl-3a-(pyrrolidine-1-carbonyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-1-yl]ethanone (PubChem CID 124799755) has the molecular formula C21H28FN3O4S and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-[(3aS,8aS)-6-(3-fluorophenyl)sulfonyl-3a-(pyrrolidine-1-carbonyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-1-yl]ethanone.
| Compound Name | 1-[(3aS,8aS)-6-(3-fluorophenyl)sulfonyl-3a-(pyrrolidine-1-carbonyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-1-yl]ethanone |
|---|---|
| PubChem CID | 124799755 |
| Molecular Formula | C21H28FN3O4S |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 1-[(3aS,8aS)-6-(3-fluorophenyl)sulfonyl-3a-(pyrrolidine-1-carbonyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@]2(C(=O)N3CCCC3)CCN(S(=O)(=O)c3cccc(F)c3)CC[C@H]12 |
| InChI | InChI=1S/C21H28FN3O4S/c1-16(26)25-14-9-21(20(27)23-10-2-3-11-23)8-13-24(12-7-19(21)25)30(28,29)18-6-4-5-17(22)15-18/h4-6,15,19H,2-3,7-14H2,1H3/t19-,21+/m0/s1 |
| InChIKey | JDIYKWHXWIWVIU-PZJWPPBQSA-N |
| XLogP | 1.84 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |