C20H26FN3O4S — CID 124802768
(3aR,6aS)-2-acetyl-5-ethyl-1'-(3-fluorophenyl)sulfonylspiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-6-one (PubChem CID 124802768) has the molecular formula C20H26FN3O4S and a molecular weight of 423.51 g/mol. Its IUPAC name is (3aR,6aS)-2-acetyl-5-ethyl-1'-(3-fluorophenyl)sulfonylspiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-6-one.
| Compound Name | (3aR,6aS)-2-acetyl-5-ethyl-1'-(3-fluorophenyl)sulfonylspiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-6-one |
|---|---|
| PubChem CID | 124802768 |
| Molecular Formula | C20H26FN3O4S |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (3aR,6aS)-2-acetyl-5-ethyl-1'-(3-fluorophenyl)sulfonylspiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-6-one |
| SMILES | CCN1C(=O)[C@@H]2CN(C(C)=O)C[C@@H]2C12CCN(S(=O)(=O)c1cccc(F)c1)CC2 |
| InChI | InChI=1S/C20H26FN3O4S/c1-3-24-19(26)17-12-22(14(2)25)13-18(17)20(24)7-9-23(10-8-20)29(27,28)16-6-4-5-15(21)11-16/h4-6,11,17-18H,3,7-10,12-13H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | UWWVRNBHQAULJX-MSOLQXFVSA-N |
| XLogP | 1.31 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |