C18H29N3O2 — CID 124800569
2-[[(4aS,7S,7aS)-4-(pyridin-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methoxy]-N,N-dimethylethanamine (PubChem CID 124800569) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-[[(4aS,7S,7aS)-4-(pyridin-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[(4aS,7S,7aS)-4-(pyridin-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 124800569 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 2-[[(4aS,7S,7aS)-4-(pyridin-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOC[C@@H]1CC[C@H]2[C@H]1OCCN2Cc1ccncc1 |
| InChI | InChI=1S/C18H29N3O2/c1-20(2)9-11-22-14-16-3-4-17-18(16)23-12-10-21(17)13-15-5-7-19-8-6-15/h5-8,16-18H,3-4,9-14H2,1-2H3/t16-,17-,18-/m0/s1 |
| InChIKey | ACAYDEMXNRJPKB-BZSNNMDCSA-N |
| XLogP | 1.64 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|