C17H28N2O3 — CID 124812149
2-[[(4aR,7S,7aS)-4-(furan-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methoxy]-N,N-dimethylethanamine (PubChem CID 124812149) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-[[(4aR,7S,7aS)-4-(furan-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[(4aR,7S,7aS)-4-(furan-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 124812149 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2-[[(4aR,7S,7aS)-4-(furan-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOC[C@@H]1CC[C@@H]2[C@H]1OCCN2Cc1ccco1 |
| InChI | InChI=1S/C17H28N2O3/c1-18(2)7-10-20-13-14-5-6-16-17(14)22-11-8-19(16)12-15-4-3-9-21-15/h3-4,9,14,16-17H,5-8,10-13H2,1-2H3/t14-,16+,17-/m0/s1 |
| InChIKey | YYWQSROMSOGCRM-UAGQMJEPSA-N |
| XLogP | 1.84 |
| TPSA | 38.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|