C16H23NO5S — CID 124800681
(8R)-8-ethoxy-2-(3-methoxyphenyl)sulfonyl-5-oxa-2-azaspiro[3.5]nonane (PubChem CID 124800681) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is (8R)-8-ethoxy-2-(3-methoxyphenyl)sulfonyl-5-oxa-2-azaspiro[3.5]nonane.
| Compound Name | (8R)-8-ethoxy-2-(3-methoxyphenyl)sulfonyl-5-oxa-2-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 124800681 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (8R)-8-ethoxy-2-(3-methoxyphenyl)sulfonyl-5-oxa-2-azaspiro[3.5]nonane |
| SMILES | CCO[C@@H]1CCOC2(C1)CN(S(=O)(=O)c1cccc(OC)c1)C2 |
| InChI | InChI=1S/C16H23NO5S/c1-3-21-14-7-8-22-16(10-14)11-17(12-16)23(18,19)15-6-4-5-13(9-15)20-2/h4-6,9,14H,3,7-8,10-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | XOBFOZGZYGAUCD-CQSZACIVSA-N |
| XLogP | 1.65 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |