C15H21NO4S2 — CID 124797789
(7S)-7-ethoxy-2-(4-methoxyphenyl)sulfonyl-5-thia-2-azaspiro[3.4]octane (PubChem CID 124797789) has the molecular formula C15H21NO4S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (7S)-7-ethoxy-2-(4-methoxyphenyl)sulfonyl-5-thia-2-azaspiro[3.4]octane.
| Compound Name | (7S)-7-ethoxy-2-(4-methoxyphenyl)sulfonyl-5-thia-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 124797789 |
| Molecular Formula | C15H21NO4S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (7S)-7-ethoxy-2-(4-methoxyphenyl)sulfonyl-5-thia-2-azaspiro[3.4]octane |
| SMILES | CCO[C@@H]1CSC2(C1)CN(S(=O)(=O)c1ccc(OC)cc1)C2 |
| InChI | InChI=1S/C15H21NO4S2/c1-3-20-13-8-15(21-9-13)10-16(11-15)22(17,18)14-6-4-12(19-2)5-7-14/h4-7,13H,3,8-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | GUVVVIGJXLJJFR-ZDUSSCGKSA-N |
| XLogP | 1.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |