C17H26N2O5S2 — CID 155878043
2-(2,5-dimethoxyphenyl)sulfonyl-N-(2-methoxyethyl)-5-thia-2-azaspiro[3.4]octan-7-amine (PubChem CID 155878043) has the molecular formula C17H26N2O5S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)sulfonyl-N-(2-methoxyethyl)-5-thia-2-azaspiro[3.4]octan-7-amine.
| Compound Name | 2-(2,5-dimethoxyphenyl)sulfonyl-N-(2-methoxyethyl)-5-thia-2-azaspiro[3.4]octan-7-amine |
|---|---|
| PubChem CID | 155878043 |
| Molecular Formula | C17H26N2O5S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)sulfonyl-N-(2-methoxyethyl)-5-thia-2-azaspiro[3.4]octan-7-amine |
| SMILES | COCCNC1CSC2(C1)CN(S(=O)(=O)c1cc(OC)ccc1OC)C2 |
| InChI | InChI=1S/C17H26N2O5S2/c1-22-7-6-18-13-9-17(25-10-13)11-19(12-17)26(20,21)16-8-14(23-2)4-5-15(16)24-3/h4-5,8,13,18H,6-7,9-12H2,1-3H3 |
| InChIKey | GIQZKIZRDSRFOE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|