C16H23N3O3S — CID 124805501
(4R,4aR,7aR)-N,N-dimethyl-1,1-dioxo-6-(pyridin-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide (PubChem CID 124805501) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is (4R,4aR,7aR)-N,N-dimethyl-1,1-dioxo-6-(pyridin-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide.
| Compound Name | (4R,4aR,7aR)-N,N-dimethyl-1,1-dioxo-6-(pyridin-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 124805501 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (4R,4aR,7aR)-N,N-dimethyl-1,1-dioxo-6-(pyridin-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
| SMILES | CN(C)C(=O)[C@@H]1CCS(=O)(=O)[C@H]2CN(Cc3cccnc3)C[C@@H]12 |
| InChI | InChI=1S/C16H23N3O3S/c1-18(2)16(20)13-5-7-23(21,22)15-11-19(10-14(13)15)9-12-4-3-6-17-8-12/h3-4,6,8,13-15H,5,7,9-11H2,1-2H3/t13-,14+,15+/m1/s1 |
| InChIKey | LDHONEXNYFAIKF-ILXRZTDVSA-N |
| XLogP | 0.40 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |