C20H30O2 — CID 124806712
(1R,2S,4S,7R,10R)-2-[(1S,2S,4S,7S,10R)-2-hydroxy-2-tricyclo[5.2.1.04,10]decanyl]tricyclo[5.2.1.04,10]decan-2-ol (PubChem CID 124806712) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1R,2S,4S,7R,10R)-2-[(1S,2S,4S,7S,10R)-2-hydroxy-2-tricyclo[5.2.1.04,10]decanyl]tricyclo[5.2.1.04,10]decan-2-ol.
| Compound Name | (1R,2S,4S,7R,10R)-2-[(1S,2S,4S,7S,10R)-2-hydroxy-2-tricyclo[5.2.1.04,10]decanyl]tricyclo[5.2.1.04,10]decan-2-ol |
|---|---|
| PubChem CID | 124806712 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1R,2S,4S,7R,10R)-2-[(1S,2S,4S,7S,10R)-2-hydroxy-2-tricyclo[5.2.1.04,10]decanyl]tricyclo[5.2.1.04,10]decan-2-ol |
| SMILES | O[C@@]1([C@]2(O)C[C@@H]3CC[C@H]4CC[C@H]2[C@H]43)C[C@@H]2CC[C@@H]3CC[C@@H]1[C@H]32 |
| InChI | InChI=1S/C20H30O2/c21-19(9-13-3-1-11-5-7-15(19)17(11)13)20(22)10-14-4-2-12-6-8-16(20)18(12)14/h11-18,21-22H,1-10H2/t11-,12+,13-,14-,15-,16+,17+,18+,19-,20-/m0/s1 |
| InChIKey | RWAAWFINOVJONO-MKGFJRJYSA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |