C16H26N2O2 — CID 124815852
(4aS,7aR)-4-[(5-methylfuran-2-yl)methyl]-6-(2-methylpropyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 124815852) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (4aS,7aR)-4-[(5-methylfuran-2-yl)methyl]-6-(2-methylpropyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aR)-4-[(5-methylfuran-2-yl)methyl]-6-(2-methylpropyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 124815852 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (4aS,7aR)-4-[(5-methylfuran-2-yl)methyl]-6-(2-methylpropyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | Cc1ccc(CN2CCO[C@@H]3CN(CC(C)C)C[C@@H]32)o1 |
| InChI | InChI=1S/C16H26N2O2/c1-12(2)8-17-10-15-16(11-17)19-7-6-18(15)9-14-5-4-13(3)20-14/h4-5,12,15-16H,6-11H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | QFZULKYZOXAHAH-JKSUJKDBSA-N |
| XLogP | 2.13 |
| TPSA | 28.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |