C56H88N2O8 — CID 124817295
tetraoctyl (1S,2S,3S,5S,6S,7R)-1,5-bis(4-methylphenyl)-1,2,3,5,6,7-hexahydropyrazolo[1,2-a]pyrazole-2,3,6,7-tetracarboxylate (PubChem CID 124817295) has the molecular formula C56H88N2O8 and a molecular weight of 917.33 g/mol. Its IUPAC name is tetraoctyl (1S,2S,3S,5S,6S,7R)-1,5-bis(4-methylphenyl)-1,2,3,5,6,7-hexahydropyrazolo[1,2-a]pyrazole-2,3,6,7-tetracarboxylate.
| Compound Name | tetraoctyl (1S,2S,3S,5S,6S,7R)-1,5-bis(4-methylphenyl)-1,2,3,5,6,7-hexahydropyrazolo[1,2-a]pyrazole-2,3,6,7-tetracarboxylate |
|---|---|
| PubChem CID | 124817295 |
| Molecular Formula | C56H88N2O8 |
| Molecular Weight | 917.33 g/mol |
| Exact Mass | 916.65 |
| IUPAC Name | tetraoctyl (1S,2S,3S,5S,6S,7R)-1,5-bis(4-methylphenyl)-1,2,3,5,6,7-hexahydropyrazolo[1,2-a]pyrazole-2,3,6,7-tetracarboxylate |
| SMILES | CCCCCCCCOC(=O)[C@@H]1[C@@H](C(=O)OCCCCCCCC)N2[C@H](c3ccc(C)cc3)[C@H](C(=O)OCCCCCCCC)[C@H](C(=O)OCCCCCCCC)N2[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C56H88N2O8/c1-7-11-15-19-23-27-39-63-53(59)47-49(45-35-31-43(5)32-36-45)57-52(56(62)66-42-30-26-22-18-14-10-4)48(54(60)64-40-28-24-20-16-12-8-2)50(46-37-33-44(6)34-38-46)58(57)51(47)55(61)65-41-29-25-21-17-13-9-3/h31-38,47-52H,7-30,39-42H2,1-6H3/t47-,48-,49+,50+,51-,52+/m0/s1 |
| InChIKey | YOKDOIQAKFBAJV-YPYOJBSPSA-N |
| XLogP | 13.22 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.33 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|