C17H28O4 — CID 124823118
(2R,3S,4S,5R)-2,4-diacetyl-3-hexyl-5-hydroxy-5-methylcyclohexan-1-one (PubChem CID 124823118) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,4-diacetyl-3-hexyl-5-hydroxy-5-methylcyclohexan-1-one.
| Compound Name | (2R,3S,4S,5R)-2,4-diacetyl-3-hexyl-5-hydroxy-5-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 124823118 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (2R,3S,4S,5R)-2,4-diacetyl-3-hexyl-5-hydroxy-5-methylcyclohexan-1-one |
| SMILES | CCCCCC[C@@H]1[C@H](C(C)=O)C(=O)C[C@@](C)(O)[C@H]1C(C)=O |
| InChI | InChI=1S/C17H28O4/c1-5-6-7-8-9-13-15(11(2)18)14(20)10-17(4,21)16(13)12(3)19/h13,15-16,21H,5-10H2,1-4H3/t13-,15+,16+,17-/m1/s1 |
| InChIKey | IZGODBBOEQDHGP-BSWAZPDLSA-N |
| XLogP | 2.71 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|