C26H32O8 — CID 163339369
15-hexyl-11-hydroxy-8-methyl-14-(2-oxohexanoyl)-4,10-dioxatetracyclo[9.4.0.02,6.08,12]pentadeca-2(6),12-diene-3,5,9-trione (PubChem CID 163339369) has the molecular formula C26H32O8 and a molecular weight of 472.53 g/mol. Its IUPAC name is 15-hexyl-11-hydroxy-8-methyl-14-(2-oxohexanoyl)-4,10-dioxatetracyclo[9.4.0.02,6.08,12]pentadeca-2(6),12-diene-3,5,9-trione.
| Compound Name | 15-hexyl-11-hydroxy-8-methyl-14-(2-oxohexanoyl)-4,10-dioxatetracyclo[9.4.0.02,6.08,12]pentadeca-2(6),12-diene-3,5,9-trione |
|---|---|
| PubChem CID | 163339369 |
| Molecular Formula | C26H32O8 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 15-hexyl-11-hydroxy-8-methyl-14-(2-oxohexanoyl)-4,10-dioxatetracyclo[9.4.0.02,6.08,12]pentadeca-2(6),12-diene-3,5,9-trione |
| SMILES | CCCCCCC1C(C(=O)C(=O)CCCC)C=C2C3(C)CC4=C(C(=O)OC4=O)C1C2(O)OC3=O |
| InChI | InChI=1S/C26H32O8/c1-4-6-8-9-10-14-15(21(28)17(27)11-7-5-2)12-18-25(3)13-16-19(23(30)33-22(16)29)20(14)26(18,32)34-24(25)31/h12,14-15,20,32H,4-11,13H2,1-3H3 |
| InChIKey | STXSSAZSBNEUIY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|