C26H36O6 — CID 134864425
(2S,10R)-2-heptyl-10-hexyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone (PubChem CID 134864425) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is (2S,10R)-2-heptyl-10-hexyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone.
| Compound Name | (2S,10R)-2-heptyl-10-hexyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone |
|---|---|
| PubChem CID | 134864425 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (2S,10R)-2-heptyl-10-hexyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone |
| SMILES | CCCCCCC[C@H]1CC2=C(C[C@@H](CCCCCC)CC3=C1C(=O)OC3=O)C(=O)OC2=O |
| InChI | InChI=1S/C26H36O6/c1-3-5-7-9-11-13-18-16-20-19(23(27)31-24(20)28)14-17(12-10-8-6-4-2)15-21-22(18)26(30)32-25(21)29/h17-18H,3-16H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | VKRWHJLWLBNYNS-MSOLQXFVSA-N |
| XLogP | 5.49 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|