C27H38O8 — CID 163187251
(5R,9S)-9-[(E)-6-hydroxyhex-4-enyl]-5-octyl-1,3-dioxo-5,8,9,10-tetrahydro-4H-cyclonona[c]furan-6,7-dicarboxylic acid (PubChem CID 163187251) has the molecular formula C27H38O8 and a molecular weight of 490.59 g/mol. Its IUPAC name is (5R,9S)-9-[(E)-6-hydroxyhex-4-enyl]-5-octyl-1,3-dioxo-5,8,9,10-tetrahydro-4H-cyclonona[c]furan-6,7-dicarboxylic acid.
| Compound Name | (5R,9S)-9-[(E)-6-hydroxyhex-4-enyl]-5-octyl-1,3-dioxo-5,8,9,10-tetrahydro-4H-cyclonona[c]furan-6,7-dicarboxylic acid |
|---|---|
| PubChem CID | 163187251 |
| Molecular Formula | C27H38O8 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | (5R,9S)-9-[(E)-6-hydroxyhex-4-enyl]-5-octyl-1,3-dioxo-5,8,9,10-tetrahydro-4H-cyclonona[c]furan-6,7-dicarboxylic acid |
| SMILES | CCCCCCCC[C@@H]1CC2=C(C[C@@H](CCC/C=C/CO)CC(C(=O)O)=C1C(=O)O)C(=O)OC2=O |
| InChI | InChI=1S/C27H38O8/c1-2-3-4-5-6-10-13-19-17-21-20(26(33)35-27(21)34)15-18(12-9-7-8-11-14-28)16-22(24(29)30)23(19)25(31)32/h8,11,18-19,28H,2-7,9-10,12-17H2,1H3,(H,29,30)(H,31,32)/b11-8+,23-22?/t18-,19-/m1/s1 |
| InChIKey | DNJJFLDGXGVLGN-XDDIKSQCSA-N |
| XLogP | 4.72 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|