C26H36O7 — CID 155978796
15-hexyl-11-hydroxy-14-(2-hydroxyhexyl)-8-methyl-4,10-dioxatetracyclo[9.4.0.02,6.08,12]pentadeca-2(6),12-diene-3,5,9-trione (PubChem CID 155978796) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is 15-hexyl-11-hydroxy-14-(2-hydroxyhexyl)-8-methyl-4,10-dioxatetracyclo[9.4.0.02,6.08,12]pentadeca-2(6),12-diene-3,5,9-trione.
| Compound Name | 15-hexyl-11-hydroxy-14-(2-hydroxyhexyl)-8-methyl-4,10-dioxatetracyclo[9.4.0.02,6.08,12]pentadeca-2(6),12-diene-3,5,9-trione |
|---|---|
| PubChem CID | 155978796 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 15-hexyl-11-hydroxy-14-(2-hydroxyhexyl)-8-methyl-4,10-dioxatetracyclo[9.4.0.02,6.08,12]pentadeca-2(6),12-diene-3,5,9-trione |
| SMILES | CCCCCCC1C(CC(O)CCCC)C=C2C3(C)CC4=C(C(=O)OC4=O)C1C2(O)OC3=O |
| InChI | InChI=1S/C26H36O7/c1-4-6-8-9-11-17-15(12-16(27)10-7-5-2)13-19-25(3)14-18-20(23(29)32-22(18)28)21(17)26(19,31)33-24(25)30/h13,15-17,21,27,31H,4-12,14H2,1-3H3 |
| InChIKey | PWYXBNKHHZEXDU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|