C31H40O8 — CID 134864428
2-[11-hydroxy-14,15-bis[(E)-oct-6-enyl]-3,5,9-trioxo-4,10-dioxatetracyclo[9.4.0.02,6.08,12]pentadeca-2(6),12-dien-8-yl]acetic acid (PubChem CID 134864428) has the molecular formula C31H40O8 and a molecular weight of 540.65 g/mol. Its IUPAC name is 2-[11-hydroxy-14,15-bis[(E)-oct-6-enyl]-3,5,9-trioxo-4,10-dioxatetracyclo[9.4.0.02,6.08,12]pentadeca-2(6),12-dien-8-yl]acetic acid.
| Compound Name | 2-[11-hydroxy-14,15-bis[(E)-oct-6-enyl]-3,5,9-trioxo-4,10-dioxatetracyclo[9.4.0.02,6.08,12]pentadeca-2(6),12-dien-8-yl]acetic acid |
|---|---|
| PubChem CID | 134864428 |
| Molecular Formula | C31H40O8 |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 2-[11-hydroxy-14,15-bis[(E)-oct-6-enyl]-3,5,9-trioxo-4,10-dioxatetracyclo[9.4.0.02,6.08,12]pentadeca-2(6),12-dien-8-yl]acetic acid |
| SMILES | C/C=C/CCCCCC1C=C2C3(CC(=O)O)CC4=C(C(=O)OC4=O)C(C1CCCCC/C=C/C)C2(O)OC3=O |
| InChI | InChI=1S/C31H40O8/c1-3-5-7-9-11-13-15-20-17-23-30(19-24(32)33)18-22-25(28(35)38-27(22)34)26(31(23,37)39-29(30)36)21(20)16-14-12-10-8-6-4-2/h3-6,17,20-21,26,37H,7-16,18-19H2,1-2H3,(H,32,33)/b5-3+,6-4+ |
| InChIKey | VHYZFYQOJOKJHH-GGWOSOGESA-N |
| XLogP | 5.32 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|