C22H29N3O2 — CID 124824015
(4S,5S)-2-benzyl-4-[[butyl(methyl)amino]methyl]-5-(2-hydroxyphenyl)pyrazolidin-3-one (PubChem CID 124824015) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is (4S,5S)-2-benzyl-4-[[butyl(methyl)amino]methyl]-5-(2-hydroxyphenyl)pyrazolidin-3-one.
| Compound Name | (4S,5S)-2-benzyl-4-[[butyl(methyl)amino]methyl]-5-(2-hydroxyphenyl)pyrazolidin-3-one |
|---|---|
| PubChem CID | 124824015 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | (4S,5S)-2-benzyl-4-[[butyl(methyl)amino]methyl]-5-(2-hydroxyphenyl)pyrazolidin-3-one |
| SMILES | CCCCN(C)C[C@@H]1C(=O)N(Cc2ccccc2)N[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C22H29N3O2/c1-3-4-14-24(2)16-19-21(18-12-8-9-13-20(18)26)23-25(22(19)27)15-17-10-6-5-7-11-17/h5-13,19,21,23,26H,3-4,14-16H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | NBKOOOMGVDBCEM-PZJWPPBQSA-N |
| XLogP | 3.33 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|