C28H32Cl2N2 — CID 124824769
(1R)-1-(1-adamantyl)-N-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methyl]ethanamine (PubChem CID 124824769) has the molecular formula C28H32Cl2N2 and a molecular weight of 467.48 g/mol. Its IUPAC name is (1R)-1-(1-adamantyl)-N-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methyl]ethanamine.
| Compound Name | (1R)-1-(1-adamantyl)-N-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 124824769 |
| Molecular Formula | C28H32Cl2N2 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | (1R)-1-(1-adamantyl)-N-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methyl]ethanamine |
| SMILES | C[C@@H](NCc1cn(Cc2ccc(Cl)c(Cl)c2)c2ccccc12)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H32Cl2N2/c1-18(28-12-20-8-21(13-28)10-22(9-20)14-28)31-15-23-17-32(27-5-3-2-4-24(23)27)16-19-6-7-25(29)26(30)11-19/h2-7,11,17-18,20-22,31H,8-10,12-16H2,1H3/t18-,20?,21?,22?,28?/m1/s1 |
| InChIKey | LRYYTUZISDYSDZ-KVLZVTGASA-N |
| XLogP | 7.69 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |