C20H29N — CID 27088604
(1S)-1-(1-adamantyl)-N-[(2-methylphenyl)methyl]ethanamine (PubChem CID 27088604) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is (1S)-1-(1-adamantyl)-N-[(2-methylphenyl)methyl]ethanamine.
| Compound Name | (1S)-1-(1-adamantyl)-N-[(2-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 27088604 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | (1S)-1-(1-adamantyl)-N-[(2-methylphenyl)methyl]ethanamine |
| SMILES | Cc1ccccc1CN[C@@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H29N/c1-14-5-3-4-6-19(14)13-21-15(2)20-10-16-7-17(11-20)9-18(8-16)12-20/h3-6,15-18,21H,7-13H2,1-2H3/t15-,16?,17?,18?,20?/m0/s1 |
| InChIKey | BVPIBDJWPQVWCW-CCLIWJKGSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |