C28H34N2 — CID 124825324
(1S)-1-(1-adamantyl)-N-[(1-benzylindol-3-yl)methyl]ethanamine (PubChem CID 124825324) has the molecular formula C28H34N2 and a molecular weight of 398.59 g/mol. Its IUPAC name is (1S)-1-(1-adamantyl)-N-[(1-benzylindol-3-yl)methyl]ethanamine.
| Compound Name | (1S)-1-(1-adamantyl)-N-[(1-benzylindol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 124825324 |
| Molecular Formula | C28H34N2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (1S)-1-(1-adamantyl)-N-[(1-benzylindol-3-yl)methyl]ethanamine |
| SMILES | C[C@H](NCc1cn(Cc2ccccc2)c2ccccc12)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H34N2/c1-20(28-14-22-11-23(15-28)13-24(12-22)16-28)29-17-25-19-30(18-21-7-3-2-4-8-21)27-10-6-5-9-26(25)27/h2-10,19-20,22-24,29H,11-18H2,1H3/t20-,22?,23?,24?,28?/m0/s1 |
| InChIKey | QCZSSJLYOOYMEQ-NVUQSHBQSA-N |
| XLogP | 6.38 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |