C16H24N2O3 — CID 124826757
(4aR,7R,7aS)-4-(2-ethoxyethyl)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 124826757) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (4aR,7R,7aS)-4-(2-ethoxyethyl)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aR,7R,7aS)-4-(2-ethoxyethyl)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 124826757 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (4aR,7R,7aS)-4-(2-ethoxyethyl)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | CCOCCN1CCO[C@H]2[C@H]1CC[C@H]2Oc1cccnc1 |
| InChI | InChI=1S/C16H24N2O3/c1-2-19-10-8-18-9-11-20-16-14(18)5-6-15(16)21-13-4-3-7-17-12-13/h3-4,7,12,14-16H,2,5-6,8-11H2,1H3/t14-,15-,16+/m1/s1 |
| InChIKey | UZQOZYXFIHPOAX-OAGGEKHMSA-N |
| XLogP | 1.73 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|