C18H29N3O2 — CID 125188332
2-[(3S,3aR,7aS)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-N,N-diethylethanamine (PubChem CID 125188332) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-[(3S,3aR,7aS)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-N,N-diethylethanamine.
| Compound Name | 2-[(3S,3aR,7aS)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 125188332 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 2-[(3S,3aR,7aS)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCN1C[C@H](Oc2cccnc2)[C@@H]2OCCC[C@@H]21 |
| InChI | InChI=1S/C18H29N3O2/c1-3-20(4-2)10-11-21-14-17(18-16(21)8-6-12-22-18)23-15-7-5-9-19-13-15/h5,7,9,13,16-18H,3-4,6,8,10-12,14H2,1-2H3/t16-,17-,18+/m0/s1 |
| InChIKey | OCFOYTANFKPUIH-OKZBNKHCSA-N |
| XLogP | 2.03 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |