C23H30N4O2S — CID 124828219
3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]propanamide (PubChem CID 124828219) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is 3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]propanamide.
| Compound Name | 3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]propanamide |
|---|---|
| PubChem CID | 124828219 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]propanamide |
| SMILES | CCOc1ccc(-c2n[nH]c(=S)n2CCC(=O)N[C@@H]2C[C@H]3C[C@H]2[C@@H]2CCC[C@H]32)cc1 |
| InChI | InChI=1S/C23H30N4O2S/c1-2-29-16-8-6-14(7-9-16)22-25-26-23(30)27(22)11-10-21(28)24-20-13-15-12-19(20)18-5-3-4-17(15)18/h6-9,15,17-20H,2-5,10-13H2,1H3,(H,24,28)(H,26,30)/t15-,17-,18-,19+,20-/m1/s1 |
| InChIKey | GNTCUBPCBKLKKX-RACLHMPKSA-N |
| XLogP | 4.34 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|