C17H22N4O — CID 124830296
(1R,2S,4S)-N-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 124830296) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is (1R,2S,4S)-N-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2S,4S)-N-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 124830296 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (1R,2S,4S)-N-[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(N[C@H]1CCCN(c2ncccn2)C1)[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C17H22N4O/c22-16(15-10-12-4-5-13(15)9-12)20-14-3-1-8-21(11-14)17-18-6-2-7-19-17/h2,4-7,12-15H,1,3,8-11H2,(H,20,22)/t12-,13-,14-,15-/m0/s1 |
| InChIKey | NSVXZXVPFGMABP-AJNGGQMLSA-N |
| XLogP | 1.77 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|