C18H31N3O4 — CID 124831442
(3aR,6aS)-5-ethyl-1'-(2-methoxyacetyl)-2-(2-methoxyethyl)spiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-6-one (PubChem CID 124831442) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is (3aR,6aS)-5-ethyl-1'-(2-methoxyacetyl)-2-(2-methoxyethyl)spiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-6-one.
| Compound Name | (3aR,6aS)-5-ethyl-1'-(2-methoxyacetyl)-2-(2-methoxyethyl)spiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-6-one |
|---|---|
| PubChem CID | 124831442 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | (3aR,6aS)-5-ethyl-1'-(2-methoxyacetyl)-2-(2-methoxyethyl)spiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-6-one |
| SMILES | CCN1C(=O)[C@@H]2CN(CCOC)C[C@@H]2C12CCN(C(=O)COC)CC2 |
| InChI | InChI=1S/C18H31N3O4/c1-4-21-17(23)14-11-19(9-10-24-2)12-15(14)18(21)5-7-20(8-6-18)16(22)13-25-3/h14-15H,4-13H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | SNNQYSRGFHATMB-CABCVRRESA-N |
| XLogP | 0.05 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |