C8H18N2 — CID 124835848
[(2R,3S)-1,3-dimethylpiperidin-2-yl]methanamine (PubChem CID 124835848) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is [(2R,3S)-1,3-dimethylpiperidin-2-yl]methanamine.
| Compound Name | [(2R,3S)-1,3-dimethylpiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 124835848 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | [(2R,3S)-1,3-dimethylpiperidin-2-yl]methanamine |
| SMILES | C[C@H]1CCCN(C)[C@H]1CN |
| InChI | InChI=1S/C8H18N2/c1-7-4-3-5-10(2)8(7)6-9/h7-8H,3-6,9H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | VQBDQIDHPIIYCS-YUMQZZPRSA-N |
| XLogP | 0.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |