C17H15IN4O3S2 — CID 1248365
2-iodo-N-[5-[[(4-methylphenyl)sulfonylamino]methyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 1248365) has the molecular formula C17H15IN4O3S2 and a molecular weight of 514.37 g/mol. Its IUPAC name is 2-iodo-N-[5-[[(4-methylphenyl)sulfonylamino]methyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-iodo-N-[5-[[(4-methylphenyl)sulfonylamino]methyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 1248365 |
| Molecular Formula | C17H15IN4O3S2 |
| Molecular Weight | 514.37 g/mol |
| Exact Mass | 513.96 |
| IUPAC Name | 2-iodo-N-[5-[[(4-methylphenyl)sulfonylamino]methyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2nnc(NC(=O)c3ccccc3I)s2)cc1 |
| InChI | InChI=1S/C17H15IN4O3S2/c1-11-6-8-12(9-7-11)27(24,25)19-10-15-21-22-17(26-15)20-16(23)13-4-2-3-5-14(13)18/h2-9,19H,10H2,1H3,(H,20,22,23) |
| InChIKey | RVUOAMROJLFZLR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|