C28H41NO3 — CID 124837798
[(5R,8S,9R,10R,13S,14R)-17-acetyl-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-pyrrolidin-1-ylpropanoate (PubChem CID 124837798) has the molecular formula C28H41NO3 and a molecular weight of 439.64 g/mol. Its IUPAC name is [(5R,8S,9R,10R,13S,14R)-17-acetyl-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-pyrrolidin-1-ylpropanoate.
| Compound Name | [(5R,8S,9R,10R,13S,14R)-17-acetyl-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-pyrrolidin-1-ylpropanoate |
|---|---|
| PubChem CID | 124837798 |
| Molecular Formula | C28H41NO3 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.31 |
| IUPAC Name | [(5R,8S,9R,10R,13S,14R)-17-acetyl-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-pyrrolidin-1-ylpropanoate |
| SMILES | CC(=O)C1=CC[C@@H]2[C@H]3CC[C@@H]4C=C(OC(=O)CCN5CCCC5)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C28H41NO3/c1-19(30)23-8-9-24-22-7-6-20-18-21(32-26(31)12-17-29-15-4-5-16-29)10-13-27(20,2)25(22)11-14-28(23,24)3/h8,18,20,22,24-25H,4-7,9-17H2,1-3H3/t20-,22-,24-,25-,27+,28-/m1/s1 |
| InChIKey | LISUREDJGUCUNG-ITILSLBESA-N |
| XLogP | 5.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |