C19H27NOS — CID 124838816
N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[(E)-3-phenylprop-2-enyl]sulfanylacetamide (PubChem CID 124838816) has the molecular formula C19H27NOS and a molecular weight of 317.50 g/mol. Its IUPAC name is N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[(E)-3-phenylprop-2-enyl]sulfanylacetamide.
| Compound Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[(E)-3-phenylprop-2-enyl]sulfanylacetamide |
|---|---|
| PubChem CID | 124838816 |
| Molecular Formula | C19H27NOS |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-[(E)-3-phenylprop-2-enyl]sulfanylacetamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)CSC/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H27NOS/c1-15-8-6-12-18(16(15)2)20-19(21)14-22-13-7-11-17-9-4-3-5-10-17/h3-5,7,9-11,15-16,18H,6,8,12-14H2,1-2H3,(H,20,21)/b11-7+/t15-,16+,18+/m1/s1 |
| InChIKey | QNPBJQMDZKYAIY-CBUONAHUSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|