C19H36NOPS — CID 143560588
N-(2,3-dimethylcyclohexyl)-2-[(2Z,4E)-4-phosphanylhepta-2,4-dienyl]sulfanylacetamide;ethane (PubChem CID 143560588) has the molecular formula C19H36NOPS and a molecular weight of 357.54 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-2-[(2Z,4E)-4-phosphanylhepta-2,4-dienyl]sulfanylacetamide;ethane.
| Compound Name | N-(2,3-dimethylcyclohexyl)-2-[(2Z,4E)-4-phosphanylhepta-2,4-dienyl]sulfanylacetamide;ethane |
|---|---|
| PubChem CID | 143560588 |
| Molecular Formula | C19H36NOPS |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-2-[(2Z,4E)-4-phosphanylhepta-2,4-dienyl]sulfanylacetamide;ethane |
| SMILES | CC.CC/C=C(P)\C=C/CSCC(=O)NC1CCCC(C)C1C |
| InChI | InChI=1S/C17H30NOPS.C2H6/c1-4-7-15(20)9-6-11-21-12-17(19)18-16-10-5-8-13(2)14(16)3;1-2/h6-7,9,13-14,16H,4-5,8,10-12,20H2,1-3H3,(H,18,19);1-2H3/b9-6-,15-7+; |
| InChIKey | BUDRYZPSFGSRTO-VOWPUKJESA-N |
| XLogP | 5.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|