C25H32N2O3 — CID 124840850
(1S,2S,4R,5S)-N-[(2S)-2-(5-methylfuran-2-yl)-2-[[(1S,2S,4R,5S)-tricyclo[3.2.1.02,4]octane-3-carbonyl]amino]ethyl]tricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 124840850) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is (1S,2S,4R,5S)-N-[(2S)-2-(5-methylfuran-2-yl)-2-[[(1S,2S,4R,5S)-tricyclo[3.2.1.02,4]octane-3-carbonyl]amino]ethyl]tricyclo[3.2.1.02,4]octane-3-carboxamide.
| Compound Name | (1S,2S,4R,5S)-N-[(2S)-2-(5-methylfuran-2-yl)-2-[[(1S,2S,4R,5S)-tricyclo[3.2.1.02,4]octane-3-carbonyl]amino]ethyl]tricyclo[3.2.1.02,4]octane-3-carboxamide |
|---|---|
| PubChem CID | 124840850 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (1S,2S,4R,5S)-N-[(2S)-2-(5-methylfuran-2-yl)-2-[[(1S,2S,4R,5S)-tricyclo[3.2.1.02,4]octane-3-carbonyl]amino]ethyl]tricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | Cc1ccc([C@H](CNC(=O)C2[C@@H]3[C@H]4CC[C@@H](C4)[C@H]23)NC(=O)C2[C@@H]3[C@H]4CC[C@@H](C4)[C@H]23)o1 |
| InChI | InChI=1S/C25H32N2O3/c1-11-2-7-17(30-11)16(27-25(29)23-20-14-5-6-15(9-14)21(20)23)10-26-24(28)22-18-12-3-4-13(8-12)19(18)22/h2,7,12-16,18-23H,3-6,8-10H2,1H3,(H,26,28)(H,27,29)/t12-,13-,14-,15-,16-,18-,19+,20-,21+,22?,23?/m0/s1 |
| InChIKey | OKQKQWRGGABPHJ-OYOQYEBBSA-N |
| XLogP | 3.45 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |