C18H22N6O2S — CID 124840873
cis-(1S,2R)-2-(5-methylthiophen-2-yl)-N-[(1R)-3-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]butyl]cyclopropane-1-carboxamide (PubChem CID 124840873) has the molecular formula C18H22N6O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is cis-(1S,2R)-2-(5-methylthiophen-2-yl)-N-[(1R)-3-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]butyl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-(5-methylthiophen-2-yl)-N-[(1R)-3-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]butyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 124840873 |
| Molecular Formula | C18H22N6O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | cis-(1S,2R)-2-(5-methylthiophen-2-yl)-N-[(1R)-3-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]butyl]cyclopropane-1-carboxamide |
| SMILES | Cc1ccc([C@@H]2C[C@@H]2C(=O)N[C@H](CC(C)C)c2nc(-c3ncn[nH]3)no2)s1 |
| InChI | InChI=1S/C18H22N6O2S/c1-9(2)6-13(18-22-16(24-26-18)15-19-8-20-23-15)21-17(25)12-7-11(12)14-5-4-10(3)27-14/h4-5,8-9,11-13H,6-7H2,1-3H3,(H,21,25)(H,19,20,23)/t11-,12+,13-/m1/s1 |
| InChIKey | PJOOTEPZNNBSMO-FRRDWIJNSA-N |
| XLogP | 3.23 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |