C20H22N6O3 — CID 97072599
3,7-dimethyl-N-[(1R)-3-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]butyl]-1-benzofuran-2-carboxamide (PubChem CID 97072599) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is 3,7-dimethyl-N-[(1R)-3-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]butyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3,7-dimethyl-N-[(1R)-3-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]butyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 97072599 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 3,7-dimethyl-N-[(1R)-3-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]butyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)N[C@H](CC(C)C)c2nc(-c3ncn[nH]3)no2)oc2c(C)cccc12 |
| InChI | InChI=1S/C20H22N6O3/c1-10(2)8-14(20-24-18(26-29-20)17-21-9-22-25-17)23-19(27)16-12(4)13-7-5-6-11(3)15(13)28-16/h5-7,9-10,14H,8H2,1-4H3,(H,23,27)(H,21,22,25)/t14-/m1/s1 |
| InChIKey | UJGRRIFRVDEKFT-CQSZACIVSA-N |
| XLogP | 3.73 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |