C18H23N7O4 — CID 75453171
1-(3,5-dimethoxyphenyl)-3-[3-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]butyl]urea (PubChem CID 75453171) has the molecular formula C18H23N7O4 and a molecular weight of 401.43 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[3-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]butyl]urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[3-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]butyl]urea |
|---|---|
| PubChem CID | 75453171 |
| Molecular Formula | C18H23N7O4 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[3-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]butyl]urea |
| SMILES | COc1cc(NC(=O)NC(CC(C)C)c2nc(-c3ncn[nH]3)no2)cc(OC)c1 |
| InChI | InChI=1S/C18H23N7O4/c1-10(2)5-14(17-23-16(25-29-17)15-19-9-20-24-15)22-18(26)21-11-6-12(27-3)8-13(7-11)28-4/h6-10,14H,5H2,1-4H3,(H,19,20,24)(H2,21,22,26) |
| InChIKey | AREXFJOYIIWHKQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |