C13H19N7OS — CID 124843924
N-[(1S)-1-(1-methyltetrazol-5-yl)ethyl]-4-thiophen-2-ylpiperazine-1-carboxamide (PubChem CID 124843924) has the molecular formula C13H19N7OS and a molecular weight of 321.41 g/mol. Its IUPAC name is N-[(1S)-1-(1-methyltetrazol-5-yl)ethyl]-4-thiophen-2-ylpiperazine-1-carboxamide.
| Compound Name | N-[(1S)-1-(1-methyltetrazol-5-yl)ethyl]-4-thiophen-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 124843924 |
| Molecular Formula | C13H19N7OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-[(1S)-1-(1-methyltetrazol-5-yl)ethyl]-4-thiophen-2-ylpiperazine-1-carboxamide |
| SMILES | C[C@H](NC(=O)N1CCN(c2cccs2)CC1)c1nnnn1C |
| InChI | InChI=1S/C13H19N7OS/c1-10(12-15-16-17-18(12)2)14-13(21)20-7-5-19(6-8-20)11-4-3-9-22-11/h3-4,9-10H,5-8H2,1-2H3,(H,14,21)/t10-/m0/s1 |
| InChIKey | FKKYREQCBDIHLU-JTQLQIEISA-N |
| XLogP | 0.86 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |