C14H24N6O2 — CID 138049854
4-cyclobutyloxy-N-[1-(1-methyltetrazol-5-yl)ethyl]piperidine-1-carboxamide (PubChem CID 138049854) has the molecular formula C14H24N6O2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 4-cyclobutyloxy-N-[1-(1-methyltetrazol-5-yl)ethyl]piperidine-1-carboxamide.
| Compound Name | 4-cyclobutyloxy-N-[1-(1-methyltetrazol-5-yl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 138049854 |
| Molecular Formula | C14H24N6O2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 4-cyclobutyloxy-N-[1-(1-methyltetrazol-5-yl)ethyl]piperidine-1-carboxamide |
| SMILES | CC(NC(=O)N1CCC(OC2CCC2)CC1)c1nnnn1C |
| InChI | InChI=1S/C14H24N6O2/c1-10(13-16-17-18-19(13)2)15-14(21)20-8-6-12(7-9-20)22-11-4-3-5-11/h10-12H,3-9H2,1-2H3,(H,15,21) |
| InChIKey | VKTKZVSGWUKNIV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |